C33H40Cl2N4O4 — CID 118394632
ethyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3,5-dimethyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1H-indole-2-carboxylate (PubChem CID 118394632) has the molecular formula C33H40Cl2N4O4 and a molecular weight of 627.61 g/mol. Its IUPAC name is ethyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3,5-dimethyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3,5-dimethyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 118394632 |
| Molecular Formula | C33H40Cl2N4O4 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | ethyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3,5-dimethyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C)nn(CCN4CCOCC4)c3C)c(Cl)ccc2c1CCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C33H40Cl2N4O4/c1-6-42-33(40)32-25(8-7-15-43-24-18-20(2)30(35)21(3)19-24)26-9-10-27(34)29(31(26)36-32)28-22(4)37-39(23(28)5)12-11-38-13-16-41-17-14-38/h9-10,18-19,36H,6-8,11-17H2,1-5H3 |
| InChIKey | ASGKRHIDIAZPJN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|