C41H50Cl2N4O5Si — CID 140791995
methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]benzoate (PubChem CID 140791995) has the molecular formula C41H50Cl2N4O5Si and a molecular weight of 777.87 g/mol. Its IUPAC name is methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 140791995 |
| Molecular Formula | C41H50Cl2N4O5Si |
| Molecular Weight | 777.87 g/mol |
| Exact Mass | 776.29 |
| IUPAC Name | methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(CO[Si](C)(C)C(C)(C)C)cc(NC(=O)c2[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc3c2CCCOc2cc(C)c(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C41H50Cl2N4O5Si/c1-23-17-30(18-24(2)36(23)43)51-16-12-13-31-32-14-15-33(42)35(34-25(3)46-47(8)26(34)4)37(32)45-38(31)39(48)44-29-20-27(19-28(21-29)40(49)50-9)22-52-53(10,11)41(5,6)7/h14-15,17-21,45H,12-13,16,22H2,1-11H3,(H,44,48) |
| InChIKey | YRXNSMUMHIWBJU-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.87 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|