C29H31ClN2O4 — CID 90083080
ethyl 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methoxy-4-methyl-3-pyridinyl)-1H-indole-2-carboxylate (PubChem CID 90083080) has the molecular formula C29H31ClN2O4 and a molecular weight of 507.03 g/mol. Its IUPAC name is ethyl 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methoxy-4-methyl-3-pyridinyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methoxy-4-methyl-3-pyridinyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 90083080 |
| Molecular Formula | C29H31ClN2O4 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | ethyl 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methoxy-4-methyl-3-pyridinyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C)ccnc3OC)cccc2c1CCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C29H31ClN2O4/c1-6-35-29(33)27-22(11-8-14-36-20-15-18(3)25(30)19(4)16-20)21-9-7-10-23(26(21)32-27)24-17(2)12-13-31-28(24)34-5/h7,9-10,12-13,15-16,32H,6,8,11,14H2,1-5H3 |
| InChIKey | KYLQPLIBKFVUNE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|