C33H30ClN3O4 — CID 118395017
3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methyl-3-pyridinyl)-1H-indole-2-carbonyl]amino]benzoic acid (PubChem CID 118395017) has the molecular formula C33H30ClN3O4 and a molecular weight of 568.07 g/mol. Its IUPAC name is 3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methyl-3-pyridinyl)-1H-indole-2-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methyl-3-pyridinyl)-1H-indole-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 118395017 |
| Molecular Formula | C33H30ClN3O4 |
| Molecular Weight | 568.07 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methyl-3-pyridinyl)-1H-indole-2-carbonyl]amino]benzoic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)Nc3cccc(C(=O)O)c3)[nH]c3c(-c4cccnc4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C33H30ClN3O4/c1-19-16-24(17-20(2)29(19)34)41-15-7-13-28-27-11-5-10-26(25-12-6-14-35-21(25)3)30(27)37-31(28)32(38)36-23-9-4-8-22(18-23)33(39)40/h4-6,8-12,14,16-18,37H,7,13,15H2,1-3H3,(H,36,38)(H,39,40) |
| InChIKey | DRCDPCIBARTALN-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.07 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|