C27H30Cl2N4O2 — CID 150878058
6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxamide (PubChem CID 150878058) has the molecular formula C27H30Cl2N4O2 and a molecular weight of 513.47 g/mol. Its IUPAC name is 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxamide.
| Compound Name | 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 150878058 |
| Molecular Formula | C27H30Cl2N4O2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(N)=O)n(C)c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C27H30Cl2N4O2/c1-14-12-18(13-15(2)24(14)29)35-11-7-8-19-20-9-10-21(28)23(22-16(3)31-33(6)17(22)4)25(20)32(5)26(19)27(30)34/h9-10,12-13H,7-8,11H2,1-6H3,(H2,30,34) |
| InChIKey | KVKPEQUXKQXHEE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|