C37H38Cl2N4O4 — CID 118394660
4-[[(3S)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-1-oxo-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]methyl]benzoic acid (PubChem CID 118394660) has the molecular formula C37H38Cl2N4O4 and a molecular weight of 673.64 g/mol. Its IUPAC name is 4-[[(3S)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-1-oxo-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3S)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-1-oxo-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 118394660 |
| Molecular Formula | C37H38Cl2N4O4 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 4-[[(3S)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-1-oxo-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]methyl]benzoic acid |
| SMILES | Cc1cc(OCCCc2c3n(c4c(-c5c(C)nn(C)c5C)c(Cl)ccc24)C[C@H](C)N(Cc2ccc(C(=O)O)cc2)C3=O)cc(C)c1Cl |
| InChI | InChI=1S/C37H38Cl2N4O4/c1-20-16-27(17-21(2)33(20)39)47-15-7-8-28-29-13-14-30(38)32(31-23(4)40-41(6)24(31)5)34(29)43-18-22(3)42(36(44)35(28)43)19-25-9-11-26(12-10-25)37(45)46/h9-14,16-17,22H,7-8,15,18-19H2,1-6H3,(H,45,46)/t22-/m0/s1 |
| InChIKey | HNUBBEAILIGAPO-QFIPXVFZSA-N |
| XLogP | 8.34 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|