C40H46N4O4 — CID 163523730
4-[[4,8-dimethyl-1-oxo-11-[3-(3,4,5-trimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-4,5-dihydro-3H-[1,4]diazepino[1,2-a]indol-2-yl]methyl]benzoic acid (PubChem CID 163523730) has the molecular formula C40H46N4O4 and a molecular weight of 646.83 g/mol. Its IUPAC name is 4-[[4,8-dimethyl-1-oxo-11-[3-(3,4,5-trimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-4,5-dihydro-3H-[1,4]diazepino[1,2-a]indol-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4,8-dimethyl-1-oxo-11-[3-(3,4,5-trimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-4,5-dihydro-3H-[1,4]diazepino[1,2-a]indol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 163523730 |
| Molecular Formula | C40H46N4O4 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | 4-[[4,8-dimethyl-1-oxo-11-[3-(3,4,5-trimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-4,5-dihydro-3H-[1,4]diazepino[1,2-a]indol-2-yl]methyl]benzoic acid |
| SMILES | Cc1cc(OCCCc2c3n(c4c(-c5c(C)nn(C)c5C)c(C)ccc24)CC(C)CN(Cc2ccc(C(=O)O)cc2)C3=O)cc(C)c1C |
| InChI | InChI=1S/C40H46N4O4/c1-23-20-43(22-30-12-14-31(15-13-30)40(46)47)39(45)38-33(10-9-17-48-32-18-25(3)27(5)26(4)19-32)34-16-11-24(2)35(37(34)44(38)21-23)36-28(6)41-42(8)29(36)7/h11-16,18-19,23H,9-10,17,20-22H2,1-8H3,(H,46,47) |
| InChIKey | DMZDYLRZPQMEDR-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|