C36H38Cl2N4O3 — CID 163604726
4-[(3R)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl]benzoic acid (PubChem CID 163604726) has the molecular formula C36H38Cl2N4O3 and a molecular weight of 645.63 g/mol. Its IUPAC name is 4-[(3R)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl]benzoic acid.
| Compound Name | 4-[(3R)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 163604726 |
| Molecular Formula | C36H38Cl2N4O3 |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 4-[(3R)-7-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-methyl-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl]benzoic acid |
| SMILES | Cc1cc(OCCCc2c3n(c4c(-c5c(C)nn(C)c5C)c(Cl)ccc24)C[C@@H](C)N(c2ccc(C(=O)O)cc2)C3)cc(C)c1Cl |
| InChI | InChI=1S/C36H38Cl2N4O3/c1-20-16-27(17-21(2)34(20)38)45-15-7-8-28-29-13-14-30(37)33(32-23(4)39-40(6)24(32)5)35(29)42-18-22(3)41(19-31(28)42)26-11-9-25(10-12-26)36(43)44/h9-14,16-17,22H,7-8,15,18-19H2,1-6H3,(H,43,44)/t22-/m1/s1 |
| InChIKey | HATBPTCOARTENT-JOCHJYFZSA-N |
| XLogP | 8.70 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|