C23H28N2O4S — CID 155322274
N-[hydroxy-[3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-indol-2-yl]methyl]methanesulfonamide (PubChem CID 155322274) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[hydroxy-[3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-indol-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[hydroxy-[3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-indol-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 155322274 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[hydroxy-[3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-indol-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC(O)c1[nH]c2ccccc2c1CCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H28N2O4S/c1-30(27,28)25-23(26)22-20(19-9-4-5-11-21(19)24-22)10-6-14-29-18-13-12-16-7-2-3-8-17(16)15-18/h4-5,9,11-13,15,23-26H,2-3,6-8,10,14H2,1H3 |
| InChIKey | DKCNWEGUHHBYNQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|