C27H31ClN2O4S — CID 123345775
N-[[3-[3-(4-butylnaphthalen-1-yl)oxypropyl]-4-chloro-1H-indol-2-yl]-hydroxymethyl]methanesulfonamide (PubChem CID 123345775) has the molecular formula C27H31ClN2O4S and a molecular weight of 515.08 g/mol. Its IUPAC name is N-[[3-[3-(4-butylnaphthalen-1-yl)oxypropyl]-4-chloro-1H-indol-2-yl]-hydroxymethyl]methanesulfonamide.
| Compound Name | N-[[3-[3-(4-butylnaphthalen-1-yl)oxypropyl]-4-chloro-1H-indol-2-yl]-hydroxymethyl]methanesulfonamide |
|---|---|
| PubChem CID | 123345775 |
| Molecular Formula | C27H31ClN2O4S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | N-[[3-[3-(4-butylnaphthalen-1-yl)oxypropyl]-4-chloro-1H-indol-2-yl]-hydroxymethyl]methanesulfonamide |
| SMILES | CCCCc1ccc(OCCCc2c(C(O)NS(C)(=O)=O)[nH]c3cccc(Cl)c23)c2ccccc12 |
| InChI | InChI=1S/C27H31ClN2O4S/c1-3-4-9-18-15-16-24(20-11-6-5-10-19(18)20)34-17-8-12-21-25-22(28)13-7-14-23(25)29-26(21)27(31)30-35(2,32)33/h5-7,10-11,13-16,27,29-31H,3-4,8-9,12,17H2,1-2H3 |
| InChIKey | IWYYQRZIUNHASW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|