C19H16Cl2O4S — CID 7574368
(2,3-dichlorophenyl) 4-propoxynaphthalene-1-sulfonate (PubChem CID 7574368) has the molecular formula C19H16Cl2O4S and a molecular weight of 411.31 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 4-propoxynaphthalene-1-sulfonate.
| Compound Name | (2,3-dichlorophenyl) 4-propoxynaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 7574368 |
| Molecular Formula | C19H16Cl2O4S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | (2,3-dichlorophenyl) 4-propoxynaphthalene-1-sulfonate |
| SMILES | CCCOc1ccc(S(=O)(=O)Oc2cccc(Cl)c2Cl)c2ccccc12 |
| InChI | InChI=1S/C19H16Cl2O4S/c1-2-12-24-16-10-11-18(14-7-4-3-6-13(14)16)26(22,23)25-17-9-5-8-15(20)19(17)21/h3-11H,2,12H2,1H3 |
| InChIKey | NGRQEPJSTCTIES-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|