About (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate
(2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate (PubChem CID 50876427) has the molecular formula C22H19NO4S
and a molecular weight of 393.46 g/mol. Its IUPAC name is (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate |
| PubChem CID | 50876427 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2cc(C)nc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C22H19NO4S/c1-3-26-20-12-13-22(17-9-5-4-8-16(17)20)28(24,25)27-21-14-15(2)23-19-11-7-6-10-18(19)21/h4-14H,3H2,1-2H3 |
| InChIKey | AQMSQGRRPFVXAL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate?
The IUPAC name of (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate (CID 50876427) is (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate.
What is the SMILES notation for (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate?
The canonical SMILES for (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate is CCOc1ccc(S(=O)(=O)Oc2cc(C)nc3ccccc23)c2ccccc12.
What is the InChIKey of (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate?
The InChIKey is AQMSQGRRPFVXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO4S/c1-3-26-20-12-13-22(17-9-5-4-8-16(17)20)28(24,25)27-21-14-15(2)23-19-11-7-6-10-18(19)21/h4-14H,3H2,1-2H3.
What are the key properties of (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate?
(2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate has a molecular weight of 393.46 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylquinolin-4-yl) 4-ethoxynaphthalene-1-sulfonate is sourced from PubChem (CID 50876427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).