C20H20O4S — CID 139016113
naphthalen-1-yl 4-ethoxy-2,5-dimethylbenzenesulfonate (PubChem CID 139016113) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is naphthalen-1-yl 4-ethoxy-2,5-dimethylbenzenesulfonate.
| Compound Name | naphthalen-1-yl 4-ethoxy-2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 139016113 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | naphthalen-1-yl 4-ethoxy-2,5-dimethylbenzenesulfonate |
| SMILES | CCOc1cc(C)c(S(=O)(=O)Oc2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C20H20O4S/c1-4-23-19-12-15(3)20(13-14(19)2)25(21,22)24-18-11-7-9-16-8-5-6-10-17(16)18/h5-13H,4H2,1-3H3 |
| InChIKey | WRIVYTZERREVOZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|