C16H9BrCl2O3S — CID 146147489
naphthalen-1-yl 2-bromo-4,5-dichlorobenzenesulfonate (PubChem CID 146147489) has the molecular formula C16H9BrCl2O3S and a molecular weight of 432.12 g/mol. Its IUPAC name is naphthalen-1-yl 2-bromo-4,5-dichlorobenzenesulfonate.
| Compound Name | naphthalen-1-yl 2-bromo-4,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 146147489 |
| Molecular Formula | C16H9BrCl2O3S |
| Molecular Weight | 432.12 g/mol |
| Exact Mass | 429.88 |
| IUPAC Name | naphthalen-1-yl 2-bromo-4,5-dichlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1cccc2ccccc12)c1cc(Cl)c(Cl)cc1Br |
| InChI | InChI=1S/C16H9BrCl2O3S/c17-12-8-13(18)14(19)9-16(12)23(20,21)22-15-7-3-5-10-4-1-2-6-11(10)15/h1-9H |
| InChIKey | AAJQDQJKGMIZGL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.12 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|