About naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate
naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate (PubChem CID 100820707) has the molecular formula C16H10FNO5S
and a molecular weight of 347.32 g/mol. Its IUPAC name is naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate |
| PubChem CID | 100820707 |
| Molecular Formula | C16H10FNO5S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Oc2cccc3ccccc23)ccc1F |
| InChI | InChI=1S/C16H10FNO5S/c17-14-9-8-12(10-15(14)18(19)20)24(21,22)23-16-7-3-5-11-4-1-2-6-13(11)16/h1-10H |
| InChIKey | BLSNPRAYIGCTBF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate?
The IUPAC name of naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate (CID 100820707) is naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate.
What is the SMILES notation for naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate?
The canonical SMILES for naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate is O=[N+]([O-])c1cc(S(=O)(=O)Oc2cccc3ccccc23)ccc1F.
What is the InChIKey of naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate?
The InChIKey is BLSNPRAYIGCTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FNO5S/c17-14-9-8-12(10-15(14)18(19)20)24(21,22)23-16-7-3-5-11-4-1-2-6-13(11)16/h1-10H.
What are the key properties of naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate?
naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate has a molecular weight of 347.32 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-yl 4-fluoro-3-nitrobenzenesulfonate is sourced from PubChem (CID 100820707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).