About (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate
(5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate (PubChem CID 18075034) has the molecular formula C12H7ClFNO5S
and a molecular weight of 331.71 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate |
| PubChem CID | 18075034 |
| Molecular Formula | C12H7ClFNO5S |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H7ClFNO5S/c13-8-1-4-10(5-2-8)21(18,19)20-12-7-9(14)3-6-11(12)15(16)17/h1-7H |
| InChIKey | ZGBMWSSYNABFCI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate?
The IUPAC name of (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate (CID 18075034) is (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate.
What is the SMILES notation for (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate?
The canonical SMILES for (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate is O=[N+]([O-])c1ccc(F)cc1OS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate?
The InChIKey is ZGBMWSSYNABFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClFNO5S/c13-8-1-4-10(5-2-8)21(18,19)20-12-7-9(14)3-6-11(12)15(16)17/h1-7H.
What are the key properties of (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate?
(5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate has a molecular weight of 331.71 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2-nitrophenyl) 4-chlorobenzenesulfonate is sourced from PubChem (CID 18075034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).