C14H10FNO6S — CID 46807919
(5-fluoro-2-nitrophenyl) 2,3-dihydro-1-benzofuran-5-sulfonate (PubChem CID 46807919) has the molecular formula C14H10FNO6S and a molecular weight of 339.30 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 2,3-dihydro-1-benzofuran-5-sulfonate.
| Compound Name | (5-fluoro-2-nitrophenyl) 2,3-dihydro-1-benzofuran-5-sulfonate |
|---|---|
| PubChem CID | 46807919 |
| Molecular Formula | C14H10FNO6S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 2,3-dihydro-1-benzofuran-5-sulfonate |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OS(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H10FNO6S/c15-10-1-3-12(16(17)18)14(8-10)22-23(19,20)11-2-4-13-9(7-11)5-6-21-13/h1-4,7-8H,5-6H2 |
| InChIKey | NTFZASLDIOYWNQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|