C12H6Br2FNO5S — CID 26949053
(5-fluoro-2-nitrophenyl) 2,5-dibromobenzenesulfonate (PubChem CID 26949053) has the molecular formula C12H6Br2FNO5S and a molecular weight of 455.06 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 2,5-dibromobenzenesulfonate.
| Compound Name | (5-fluoro-2-nitrophenyl) 2,5-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 26949053 |
| Molecular Formula | C12H6Br2FNO5S |
| Molecular Weight | 455.06 g/mol |
| Exact Mass | 452.83 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 2,5-dibromobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H6Br2FNO5S/c13-7-1-3-9(14)12(5-7)22(19,20)21-11-6-8(15)2-4-10(11)16(17)18/h1-6H |
| InChIKey | GYMOXVJPWXVLCX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.06 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|