C15H14BrClO5S — CID 27664128
(2-chloro-5-methylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate (PubChem CID 27664128) has the molecular formula C15H14BrClO5S and a molecular weight of 421.70 g/mol. Its IUPAC name is (2-chloro-5-methylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate.
| Compound Name | (2-chloro-5-methylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 27664128 |
| Molecular Formula | C15H14BrClO5S |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | (2-chloro-5-methylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate |
| SMILES | COc1cc(Br)c(S(=O)(=O)Oc2cc(C)ccc2Cl)cc1OC |
| InChI | InChI=1S/C15H14BrClO5S/c1-9-4-5-11(17)12(6-9)22-23(18,19)15-8-14(21-3)13(20-2)7-10(15)16/h4-8H,1-3H3 |
| InChIKey | KQJKVDTUSXZJOX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|