C16H17BrO5S — CID 46823320
(2,3-dimethylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate (PubChem CID 46823320) has the molecular formula C16H17BrO5S and a molecular weight of 401.28 g/mol. Its IUPAC name is (2,3-dimethylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate.
| Compound Name | (2,3-dimethylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 46823320 |
| Molecular Formula | C16H17BrO5S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | (2,3-dimethylphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate |
| SMILES | COc1cc(Br)c(S(=O)(=O)Oc2cccc(C)c2C)cc1OC |
| InChI | InChI=1S/C16H17BrO5S/c1-10-6-5-7-13(11(10)2)22-23(18,19)16-9-15(21-4)14(20-3)8-12(16)17/h5-9H,1-4H3 |
| InChIKey | FKBGALGRDIRFSX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|