C16H18O4S — CID 23312101
1,2-dimethoxy-4-methyl-5-(2-methylphenyl)sulfonylbenzene (PubChem CID 23312101) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 1,2-dimethoxy-4-methyl-5-(2-methylphenyl)sulfonylbenzene.
| Compound Name | 1,2-dimethoxy-4-methyl-5-(2-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 23312101 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1,2-dimethoxy-4-methyl-5-(2-methylphenyl)sulfonylbenzene |
| SMILES | COc1cc(C)c(S(=O)(=O)c2ccccc2C)cc1OC |
| InChI | InChI=1S/C16H18O4S/c1-11-7-5-6-8-15(11)21(17,18)16-10-14(20-4)13(19-3)9-12(16)2/h5-10H,1-4H3 |
| InChIKey | ZBMGVSMVUKCKFC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |