C9H13NO4S — CID 35299033
4,5-dimethoxy-2-methylbenzenesulfonamide (PubChem CID 35299033) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methylbenzenesulfonamide.
| Compound Name | 4,5-dimethoxy-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 35299033 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4,5-dimethoxy-2-methylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(N)(=O)=O)cc1OC |
| InChI | InChI=1S/C9H13NO4S/c1-6-4-7(13-2)8(14-3)5-9(6)15(10,11)12/h4-5H,1-3H3,(H2,10,11,12) |
| InChIKey | ILIDHKYQCNECHQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |