C9H11FO4S — CID 82475781
4,5-dimethoxy-2-methylbenzenesulfonyl fluoride (PubChem CID 82475781) has the molecular formula C9H11FO4S and a molecular weight of 234.25 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methylbenzenesulfonyl fluoride.
| Compound Name | 4,5-dimethoxy-2-methylbenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 82475781 |
| Molecular Formula | C9H11FO4S |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 4,5-dimethoxy-2-methylbenzenesulfonyl fluoride |
| SMILES | COc1cc(C)c(S(=O)(=O)F)cc1OC |
| InChI | InChI=1S/C9H11FO4S/c1-6-4-7(13-2)8(14-3)5-9(6)15(10,11)12/h4-5H,1-3H3 |
| InChIKey | DUHHQUYZBZMHMM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |