C13H21NO3S — CID 2284278
N,N-diethyl-5-methoxy-2,4-dimethylbenzenesulfonamide (PubChem CID 2284278) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is N,N-diethyl-5-methoxy-2,4-dimethylbenzenesulfonamide.
| Compound Name | N,N-diethyl-5-methoxy-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2284278 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N,N-diethyl-5-methoxy-2,4-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(OC)c(C)cc1C |
| InChI | InChI=1S/C13H21NO3S/c1-6-14(7-2)18(15,16)13-9-12(17-5)10(3)8-11(13)4/h8-9H,6-7H2,1-5H3 |
| InChIKey | QAWRILUHGOGSRD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |