C12H20N2O3S — CID 79973956
5-amino-N,N-diethyl-2-methoxy-4-methylbenzenesulfonamide (PubChem CID 79973956) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-amino-N,N-diethyl-2-methoxy-4-methylbenzenesulfonamide.
| Compound Name | 5-amino-N,N-diethyl-2-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79973956 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-amino-N,N-diethyl-2-methoxy-4-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(N)c(C)cc1OC |
| InChI | InChI=1S/C12H20N2O3S/c1-5-14(6-2)18(15,16)12-8-10(13)9(3)7-11(12)17-4/h7-8H,5-6,13H2,1-4H3 |
| InChIKey | FYJXSMQHXSGHDY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|