C13H18N2O4S — CID 102946052
5-amino-N-ethyl-2,4-dimethoxy-N-prop-2-ynylbenzenesulfonamide (PubChem CID 102946052) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 5-amino-N-ethyl-2,4-dimethoxy-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 5-amino-N-ethyl-2,4-dimethoxy-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 102946052 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-amino-N-ethyl-2,4-dimethoxy-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC)S(=O)(=O)c1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C13H18N2O4S/c1-5-7-15(6-2)20(16,17)13-8-10(14)11(18-3)9-12(13)19-4/h1,8-9H,6-7,14H2,2-4H3 |
| InChIKey | IPSXKLJVUHXIBM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|