C12H14N2O5S — CID 78970291
N-ethyl-2-methoxy-5-nitro-N-prop-2-ynylbenzenesulfonamide (PubChem CID 78970291) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is N-ethyl-2-methoxy-5-nitro-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-ethyl-2-methoxy-5-nitro-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 78970291 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-ethyl-2-methoxy-5-nitro-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C12H14N2O5S/c1-4-8-13(5-2)20(17,18)12-9-10(14(15)16)6-7-11(12)19-3/h1,6-7,9H,5,8H2,2-3H3 |
| InChIKey | YYFUKPJNSNKKGF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|