C10H14N2O6S — CID 15590967
N-(2-hydroxyethyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide (PubChem CID 15590967) has the molecular formula C10H14N2O6S and a molecular weight of 290.30 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 15590967 |
| Molecular Formula | C10H14N2O6S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-(2-hydroxyethyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)CCO |
| InChI | InChI=1S/C10H14N2O6S/c1-11(5-6-13)19(16,17)10-7-8(12(14)15)3-4-9(10)18-2/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | OINVVAQOFPSVKO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|