C17H19Cl2N3O5S — CID 59260852
2-(3,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-methyl-5-nitrobenzenesulfonamide (PubChem CID 59260852) has the molecular formula C17H19Cl2N3O5S and a molecular weight of 448.33 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 59260852 |
| Molecular Formula | C17H19Cl2N3O5S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-methyl-5-nitrobenzenesulfonamide |
| SMILES | CN(C)CCN(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2N3O5S/c1-20(2)6-7-21(3)28(25,26)17-11-14(22(23)24)4-5-16(17)27-15-9-12(18)8-13(19)10-15/h4-5,8-11H,6-7H2,1-3H3 |
| InChIKey | UGOXQWJFXKALGA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|