C11H13ClN2O4S — CID 114265138
N-but-3-enyl-2-chloro-N-methyl-5-nitrobenzenesulfonamide (PubChem CID 114265138) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is N-but-3-enyl-2-chloro-N-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-but-3-enyl-2-chloro-N-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 114265138 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-but-3-enyl-2-chloro-N-methyl-5-nitrobenzenesulfonamide |
| SMILES | C=CCCN(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H13ClN2O4S/c1-3-4-7-13(2)19(17,18)11-8-9(14(15)16)5-6-10(11)12/h3,5-6,8H,1,4,7H2,2H3 |
| InChIKey | CUVWOUHJGBGUSA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|