C12H18ClN3O4S — CID 79645775
N-(3-amino-2,2-dimethylpropyl)-2-chloro-N-methyl-4-nitrobenzenesulfonamide (PubChem CID 79645775) has the molecular formula C12H18ClN3O4S and a molecular weight of 335.81 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-chloro-N-methyl-4-nitrobenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-chloro-N-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 79645775 |
| Molecular Formula | C12H18ClN3O4S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-chloro-N-methyl-4-nitrobenzenesulfonamide |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H18ClN3O4S/c1-12(2,7-14)8-15(3)21(19,20)11-5-4-9(16(17)18)6-10(11)13/h4-6H,7-8,14H2,1-3H3 |
| InChIKey | OAJDHZJRHOMZAF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|