C13H22ClN3O5S — CID 119991442
N-(3-amino-2,2-dimethylpropyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119991442) has the molecular formula C13H22ClN3O5S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119991442 |
| Molecular Formula | C13H22ClN3O5S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-methoxy-N-methyl-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)CC(C)(C)CN.Cl |
| InChI | InChI=1S/C13H21N3O5S.ClH/c1-13(2,8-14)9-15(3)22(19,20)12-7-10(16(17)18)5-6-11(12)21-4;/h5-7H,8-9,14H2,1-4H3;1H |
| InChIKey | ZIJGOJTUKCPCCW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|