C13H21N3O4S — CID 79648197
N-(3-amino-2,2-dimethylpropyl)-N-methyl-1-(4-nitrophenyl)methanesulfonamide (PubChem CID 79648197) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-1-(4-nitrophenyl)methanesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-1-(4-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 79648197 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-1-(4-nitrophenyl)methanesulfonamide |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H21N3O4S/c1-13(2,9-14)10-15(3)21(19,20)8-11-4-6-12(7-5-11)16(17)18/h4-7H,8-10,14H2,1-3H3 |
| InChIKey | DXLKRJAQZISZSU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|