C13H20N2O4S — CID 52561105
1-(4-nitrophenyl)-N,N-dipropylmethanesulfonamide (PubChem CID 52561105) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N,N-dipropylmethanesulfonamide.
| Compound Name | 1-(4-nitrophenyl)-N,N-dipropylmethanesulfonamide |
|---|---|
| PubChem CID | 52561105 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(4-nitrophenyl)-N,N-dipropylmethanesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-3-9-14(10-4-2)20(18,19)11-12-5-7-13(8-6-12)15(16)17/h5-8H,3-4,9-11H2,1-2H3 |
| InChIKey | SERYCOVBWTYMIF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|