C19H19Cl2N3O7S — CID 59260893
3-[4-[2-(3,5-dichlorophenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]propanoic acid (PubChem CID 59260893) has the molecular formula C19H19Cl2N3O7S and a molecular weight of 504.35 g/mol. Its IUPAC name is 3-[4-[2-(3,5-dichlorophenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[2-(3,5-dichlorophenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 59260893 |
| Molecular Formula | C19H19Cl2N3O7S |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 3-[4-[2-(3,5-dichlorophenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2Oc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H19Cl2N3O7S/c20-13-9-14(21)11-16(10-13)31-17-2-1-15(24(27)28)12-18(17)32(29,30)23-7-5-22(6-8-23)4-3-19(25)26/h1-2,9-12H,3-8H2,(H,25,26) |
| InChIKey | SOBXXPDVTMDHGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|