C23H29N3O5S — CID 59260936
1-cyclopentyl-4-[2-(3,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazine (PubChem CID 59260936) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 1-cyclopentyl-4-[2-(3,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazine.
| Compound Name | 1-cyclopentyl-4-[2-(3,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 59260936 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 1-cyclopentyl-4-[2-(3,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazine |
| SMILES | Cc1cc(C)cc(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCN(C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C23H29N3O5S/c1-17-13-18(2)15-21(14-17)31-22-8-7-20(26(27)28)16-23(22)32(29,30)25-11-9-24(10-12-25)19-5-3-4-6-19/h7-8,13-16,19H,3-6,9-12H2,1-2H3 |
| InChIKey | QDTBQDTWWCZTBB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|