C24H33N3O3S — CID 89022729
3-(4-cyclohexylpiperazin-1-yl)sulfonyl-4-(2,5-dimethylphenoxy)aniline (PubChem CID 89022729) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 3-(4-cyclohexylpiperazin-1-yl)sulfonyl-4-(2,5-dimethylphenoxy)aniline.
| Compound Name | 3-(4-cyclohexylpiperazin-1-yl)sulfonyl-4-(2,5-dimethylphenoxy)aniline |
|---|---|
| PubChem CID | 89022729 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 3-(4-cyclohexylpiperazin-1-yl)sulfonyl-4-(2,5-dimethylphenoxy)aniline |
| SMILES | Cc1ccc(C)c(Oc2ccc(N)cc2S(=O)(=O)N2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H33N3O3S/c1-18-8-9-19(2)23(16-18)30-22-11-10-20(25)17-24(22)31(28,29)27-14-12-26(13-15-27)21-6-4-3-5-7-21/h8-11,16-17,21H,3-7,12-15,25H2,1-2H3 |
| InChIKey | CLODITQSFUEXTD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|