C20H27N3O3S — CID 59442855
4-(3,5-dimethylphenoxy)-3-(4-ethylpiperazin-1-yl)sulfonylaniline (PubChem CID 59442855) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-(3,5-dimethylphenoxy)-3-(4-ethylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 4-(3,5-dimethylphenoxy)-3-(4-ethylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 59442855 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-(3,5-dimethylphenoxy)-3-(4-ethylpiperazin-1-yl)sulfonylaniline |
| SMILES | CCN1CCN(S(=O)(=O)c2cc(N)ccc2Oc2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C20H27N3O3S/c1-4-22-7-9-23(10-8-22)27(24,25)20-14-17(21)5-6-19(20)26-18-12-15(2)11-16(3)13-18/h5-6,11-14H,4,7-10,21H2,1-3H3 |
| InChIKey | VAWIEWRMXBYJPH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|