C18H21IN2O3S — CID 59260774
1-[2-(3,5-dimethylphenoxy)-5-iodophenyl]sulfonylpiperazine (PubChem CID 59260774) has the molecular formula C18H21IN2O3S and a molecular weight of 472.35 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)-5-iodophenyl]sulfonylpiperazine.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)-5-iodophenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 59260774 |
| Molecular Formula | C18H21IN2O3S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)-5-iodophenyl]sulfonylpiperazine |
| SMILES | Cc1cc(C)cc(Oc2ccc(I)cc2S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H21IN2O3S/c1-13-9-14(2)11-16(10-13)24-17-4-3-15(19)12-18(17)25(22,23)21-7-5-20-6-8-21/h3-4,9-12,20H,5-8H2,1-2H3 |
| InChIKey | RCKXVDVREAUCKB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|