C19H21Cl2N3O4S — CID 59260923
4-(3,5-dichlorophenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide (PubChem CID 59260923) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is 4-(3,5-dichlorophenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide.
| Compound Name | 4-(3,5-dichlorophenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 59260923 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 4-(3,5-dichlorophenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2cc(Cl)cc(Cl)c2)c(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C19H21Cl2N3O4S/c1-23(2)19(25)13-3-4-17(28-16-11-14(20)10-15(21)12-16)18(9-13)29(26,27)24-7-5-22-6-8-24/h3-4,9-12,22H,5-8H2,1-2H3 |
| InChIKey | CKKPRWHRIXSEGK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |