C21H27N3O4S — CID 67547734
4-(3,5-dimethylphenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide (PubChem CID 67547734) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-(3,5-dimethylphenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide.
| Compound Name | 4-(3,5-dimethylphenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 67547734 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-(3,5-dimethylphenoxy)-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide |
| SMILES | Cc1cc(C)cc(Oc2ccc(C(=O)N(C)C)cc2S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C21H27N3O4S/c1-15-11-16(2)13-18(12-15)28-19-6-5-17(21(25)23(3)4)14-20(19)29(26,27)24-9-7-22-8-10-24/h5-6,11-14,22H,7-10H2,1-4H3 |
| InChIKey | HYEROYRIMQLLFQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |