C27H33N3O3S — CID 139946557
4-(3,5-dimethylphenoxy)-N-(3-phenylpropyl)-3-piperazin-1-ylsulfonylaniline (PubChem CID 139946557) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is 4-(3,5-dimethylphenoxy)-N-(3-phenylpropyl)-3-piperazin-1-ylsulfonylaniline.
| Compound Name | 4-(3,5-dimethylphenoxy)-N-(3-phenylpropyl)-3-piperazin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 139946557 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 4-(3,5-dimethylphenoxy)-N-(3-phenylpropyl)-3-piperazin-1-ylsulfonylaniline |
| SMILES | Cc1cc(C)cc(Oc2ccc(NCCCc3ccccc3)cc2S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C27H33N3O3S/c1-21-17-22(2)19-25(18-21)33-26-11-10-24(29-12-6-9-23-7-4-3-5-8-23)20-27(26)34(31,32)30-15-13-28-14-16-30/h3-5,7-8,10-11,17-20,28-29H,6,9,12-16H2,1-2H3 |
| InChIKey | UMJFZOWNJCQHAE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|