C21H30N2 — CID 143044158
ethane;N-(3-phenylpropyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine (PubChem CID 143044158) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is ethane;N-(3-phenylpropyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine.
| Compound Name | ethane;N-(3-phenylpropyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 143044158 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | ethane;N-(3-phenylpropyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine |
| SMILES | CC.c1ccc(CCCNc2ccc3c(c2)CCNCC3)cc1 |
| InChI | InChI=1S/C19H24N2.C2H6/c1-2-5-16(6-3-1)7-4-12-21-19-9-8-17-10-13-20-14-11-18(17)15-19;1-2/h1-3,5-6,8-9,15,20-21H,4,7,10-14H2;1-2H3 |
| InChIKey | KJQGWINUUGQWNS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|