C21H30N2 — CID 83963050
4-[2-(diethylamino)ethyl]-N-(3-phenylpropyl)aniline (PubChem CID 83963050) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethyl]-N-(3-phenylpropyl)aniline.
| Compound Name | 4-[2-(diethylamino)ethyl]-N-(3-phenylpropyl)aniline |
|---|---|
| PubChem CID | 83963050 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 4-[2-(diethylamino)ethyl]-N-(3-phenylpropyl)aniline |
| SMILES | CCN(CC)CCc1ccc(NCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H30N2/c1-3-23(4-2)18-16-20-12-14-21(15-13-20)22-17-8-11-19-9-6-5-7-10-19/h5-7,9-10,12-15,22H,3-4,8,11,16-18H2,1-2H3 |
| InChIKey | FHDGYCRPIHASEX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|