C14H23ClN2 — CID 107913689
N-[4-(2-chloroethyl)phenyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 107913689) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is N-[4-(2-chloroethyl)phenyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[4-(2-chloroethyl)phenyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 107913689 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[4-(2-chloroethyl)phenyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(CCCl)cc1 |
| InChI | InChI=1S/C14H23ClN2/c1-3-17(4-2)12-11-16-14-7-5-13(6-8-14)9-10-15/h5-8,16H,3-4,9-12H2,1-2H3 |
| InChIKey | SBQFDUBOWKLISV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|