C16H15BrCl2N2O3S — CID 59260730
1-[5-bromo-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperazine (PubChem CID 59260730) has the molecular formula C16H15BrCl2N2O3S and a molecular weight of 466.18 g/mol. Its IUPAC name is 1-[5-bromo-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperazine.
| Compound Name | 1-[5-bromo-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 59260730 |
| Molecular Formula | C16H15BrCl2N2O3S |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | 1-[5-bromo-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1cc(Br)ccc1Oc1cc(Cl)cc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C16H15BrCl2N2O3S/c17-11-1-2-15(24-14-9-12(18)8-13(19)10-14)16(7-11)25(22,23)21-5-3-20-4-6-21/h1-2,7-10,20H,3-6H2 |
| InChIKey | SPLFTRDCGYWULR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |