C17H17Cl4N3O3S — CID 142764853
4-(2,5-dichlorophenoxy)-3-piperazin-1-ylsulfonylbenzonitrile;dihydrochloride (PubChem CID 142764853) has the molecular formula C17H17Cl4N3O3S and a molecular weight of 485.22 g/mol. Its IUPAC name is 4-(2,5-dichlorophenoxy)-3-piperazin-1-ylsulfonylbenzonitrile;dihydrochloride.
| Compound Name | 4-(2,5-dichlorophenoxy)-3-piperazin-1-ylsulfonylbenzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 142764853 |
| Molecular Formula | C17H17Cl4N3O3S |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | 4-(2,5-dichlorophenoxy)-3-piperazin-1-ylsulfonylbenzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1ccc(Oc2cc(Cl)ccc2Cl)c(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H15Cl2N3O3S.2ClH/c18-13-2-3-14(19)16(10-13)25-15-4-1-12(11-20)9-17(15)26(23,24)22-7-5-21-6-8-22;;/h1-4,9-10,21H,5-8H2;2*1H |
| InChIKey | OETTYBKBCOXHMS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |