C16H23ClN2O3S — CID 120707063
1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonyl-1,4-diazepane (PubChem CID 120707063) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is 1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonyl-1,4-diazepane.
| Compound Name | 1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 120707063 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1cc(Cl)ccc1OCC1CCC1)N1CCCNCC1 |
| InChI | InChI=1S/C16H23ClN2O3S/c17-14-5-6-15(22-12-13-3-1-4-13)16(11-14)23(20,21)19-9-2-7-18-8-10-19/h5-6,11,13,18H,1-4,7-10,12H2 |
| InChIKey | HPGJPWKFCZFCMY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |