C17H25ClN2O3S — CID 120708033
[1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonylpiperidin-2-yl]methanamine (PubChem CID 120708033) has the molecular formula C17H25ClN2O3S and a molecular weight of 372.92 g/mol. Its IUPAC name is [1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonylpiperidin-2-yl]methanamine.
| Compound Name | [1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 120708033 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [1-[5-chloro-2-(cyclobutylmethoxy)phenyl]sulfonylpiperidin-2-yl]methanamine |
| SMILES | NCC1CCCCN1S(=O)(=O)c1cc(Cl)ccc1OCC1CCC1 |
| InChI | InChI=1S/C17H25ClN2O3S/c18-14-7-8-16(23-12-13-4-3-5-13)17(10-14)24(21,22)20-9-2-1-6-15(20)11-19/h7-8,10,13,15H,1-6,9,11-12,19H2 |
| InChIKey | QSVIQIKZFIPTCR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |