C17H23ClN2O4S2 — CID 27241017
2-(4-chloro-2-thiomorpholin-4-ylsulfonylphenoxy)-N-cyclopentylacetamide (PubChem CID 27241017) has the molecular formula C17H23ClN2O4S2 and a molecular weight of 418.97 g/mol. Its IUPAC name is 2-(4-chloro-2-thiomorpholin-4-ylsulfonylphenoxy)-N-cyclopentylacetamide.
| Compound Name | 2-(4-chloro-2-thiomorpholin-4-ylsulfonylphenoxy)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 27241017 |
| Molecular Formula | C17H23ClN2O4S2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-(4-chloro-2-thiomorpholin-4-ylsulfonylphenoxy)-N-cyclopentylacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1S(=O)(=O)N1CCSCC1)NC1CCCC1 |
| InChI | InChI=1S/C17H23ClN2O4S2/c18-13-5-6-15(24-12-17(21)19-14-3-1-2-4-14)16(11-13)26(22,23)20-7-9-25-10-8-20/h5-6,11,14H,1-4,7-10,12H2,(H,19,21) |
| InChIKey | XABUEGWISQMUDM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |